C25H28O3S — CID 143374254
3-[4-(3-hydroxypropoxy)-3,5-dimethylphenyl]-1-(5-methyl-4-phenylthiophen-2-yl)propan-1-one (PubChem CID 143374254) has the molecular formula C25H28O3S and a molecular weight of 408.56 g/mol. Its IUPAC name is 3-[4-(3-hydroxypropoxy)-3,5-dimethylphenyl]-1-(5-methyl-4-phenylthiophen-2-yl)propan-1-one.
| Compound Name | 3-[4-(3-hydroxypropoxy)-3,5-dimethylphenyl]-1-(5-methyl-4-phenylthiophen-2-yl)propan-1-one |
|---|---|
| PubChem CID | 143374254 |
| Molecular Formula | C25H28O3S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-[4-(3-hydroxypropoxy)-3,5-dimethylphenyl]-1-(5-methyl-4-phenylthiophen-2-yl)propan-1-one |
| SMILES | Cc1cc(CCC(=O)c2cc(-c3ccccc3)c(C)s2)cc(C)c1OCCCO |
| InChI | InChI=1S/C25H28O3S/c1-17-14-20(15-18(2)25(17)28-13-7-12-26)10-11-23(27)24-16-22(19(3)29-24)21-8-5-4-6-9-21/h4-6,8-9,14-16,26H,7,10-13H2,1-3H3 |
| InChIKey | JOOYAQHEZWWNKC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|