C14H19ClO3 — CID 142212155
2-[(4-chloro-3-methylphenyl)methyl]oxane;formic acid (PubChem CID 142212155) has the molecular formula C14H19ClO3 and a molecular weight of 270.76 g/mol. Its IUPAC name is 2-[(4-chloro-3-methylphenyl)methyl]oxane;formic acid.
| Compound Name | 2-[(4-chloro-3-methylphenyl)methyl]oxane;formic acid |
|---|---|
| PubChem CID | 142212155 |
| Molecular Formula | C14H19ClO3 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-[(4-chloro-3-methylphenyl)methyl]oxane;formic acid |
| SMILES | Cc1cc(CC2CCCCO2)ccc1Cl.O=CO |
| InChI | InChI=1S/C13H17ClO.CH2O2/c1-10-8-11(5-6-13(10)14)9-12-4-2-3-7-15-12;2-1-3/h5-6,8,12H,2-4,7,9H2,1H3;1H,(H,2,3) |
| InChIKey | ZGFISUKPALDFNB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|