C22H26Cl2O3 — CID 142212141
2-[(3,4-dichlorophenyl)methyl]oxane;2,3-dihydro-1H-indene;formic acid (PubChem CID 142212141) has the molecular formula C22H26Cl2O3 and a molecular weight of 409.35 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyl]oxane;2,3-dihydro-1H-indene;formic acid.
| Compound Name | 2-[(3,4-dichlorophenyl)methyl]oxane;2,3-dihydro-1H-indene;formic acid |
|---|---|
| PubChem CID | 142212141 |
| Molecular Formula | C22H26Cl2O3 |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyl]oxane;2,3-dihydro-1H-indene;formic acid |
| SMILES | Clc1ccc(CC2CCCCO2)cc1Cl.O=CO.c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C12H14Cl2O.C9H10.CH2O2/c13-11-5-4-9(8-12(11)14)7-10-3-1-2-6-15-10;1-2-5-9-7-3-6-8(9)4-1;2-1-3/h4-5,8,10H,1-3,6-7H2;1-2,4-5H,3,6-7H2;1H,(H,2,3) |
| InChIKey | SCJIQMWKESWZKM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|