C27H30ClF2N3O4S — CID 142212485
4-chloro-N-(2,5-difluorophenyl)-N-[1-[4-(hydroxyamino)benzoyl]azepan-4-yl]benzenesulfonamide;ethane (PubChem CID 142212485) has the molecular formula C27H30ClF2N3O4S and a molecular weight of 566.07 g/mol. Its IUPAC name is 4-chloro-N-(2,5-difluorophenyl)-N-[1-[4-(hydroxyamino)benzoyl]azepan-4-yl]benzenesulfonamide;ethane.
| Compound Name | 4-chloro-N-(2,5-difluorophenyl)-N-[1-[4-(hydroxyamino)benzoyl]azepan-4-yl]benzenesulfonamide;ethane |
|---|---|
| PubChem CID | 142212485 |
| Molecular Formula | C27H30ClF2N3O4S |
| Molecular Weight | 566.07 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | 4-chloro-N-(2,5-difluorophenyl)-N-[1-[4-(hydroxyamino)benzoyl]azepan-4-yl]benzenesulfonamide;ethane |
| SMILES | CC.O=C(c1ccc(NO)cc1)N1CCCC(N(c2cc(F)ccc2F)S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C25H24ClF2N3O4S.C2H6/c26-18-5-10-22(11-6-18)36(34,35)31(24-16-19(27)7-12-23(24)28)21-2-1-14-30(15-13-21)25(32)17-3-8-20(29-33)9-4-17;1-2/h3-12,16,21,29,33H,1-2,13-15H2;1-2H3 |
| InChIKey | LTNKQYIGDVZTCM-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.07 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|