C24H21ClF2N2O3S — CID 58718366
N-(1-benzoylpiperidin-4-yl)-4-chloro-N-(2,5-difluorophenyl)benzenesulfonamide (PubChem CID 58718366) has the molecular formula C24H21ClF2N2O3S and a molecular weight of 490.96 g/mol. Its IUPAC name is N-(1-benzoylpiperidin-4-yl)-4-chloro-N-(2,5-difluorophenyl)benzenesulfonamide.
| Compound Name | N-(1-benzoylpiperidin-4-yl)-4-chloro-N-(2,5-difluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 58718366 |
| Molecular Formula | C24H21ClF2N2O3S |
| Molecular Weight | 490.96 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | N-(1-benzoylpiperidin-4-yl)-4-chloro-N-(2,5-difluorophenyl)benzenesulfonamide |
| SMILES | O=C(c1ccccc1)N1CCC(N(c2cc(F)ccc2F)S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H21ClF2N2O3S/c25-18-6-9-21(10-7-18)33(31,32)29(23-16-19(26)8-11-22(23)27)20-12-14-28(15-13-20)24(30)17-4-2-1-3-5-17/h1-11,16,20H,12-15H2 |
| InChIKey | QIGXYKAITTXWMB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.96 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |