C17H28N4O2 — CID 142215023
(2E,4Z)-2-[1-[3-(furan-2-ylmethylamino)propylamino]propan-2-yl]hexa-2,4-dienehydrazide (PubChem CID 142215023) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is (2E,4Z)-2-[1-[3-(furan-2-ylmethylamino)propylamino]propan-2-yl]hexa-2,4-dienehydrazide.
| Compound Name | (2E,4Z)-2-[1-[3-(furan-2-ylmethylamino)propylamino]propan-2-yl]hexa-2,4-dienehydrazide |
|---|---|
| PubChem CID | 142215023 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (2E,4Z)-2-[1-[3-(furan-2-ylmethylamino)propylamino]propan-2-yl]hexa-2,4-dienehydrazide |
| SMILES | C/C=C\C=C(\C(=O)NN)C(C)CNCCCNCc1ccco1 |
| InChI | InChI=1S/C17H28N4O2/c1-3-4-8-16(17(22)21-18)14(2)12-19-9-6-10-20-13-15-7-5-11-23-15/h3-5,7-8,11,14,19-20H,6,9-10,12-13,18H2,1-2H3,(H,21,22)/b4-3-,16-8+ |
| InChIKey | MJDMTCHHRQSWQM-DLDBRETFSA-N |
| XLogP | 1.48 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|