C14H31BrN4O2 — CID 142215971
2-bromo-N'-(2-methylpropyl)-N'-(2-oxoethyl)acetohydrazide;1,2-dimethyl-1-(2-methylpropyl)hydrazine (PubChem CID 142215971) has the molecular formula C14H31BrN4O2 and a molecular weight of 367.33 g/mol. Its IUPAC name is 2-bromo-N'-(2-methylpropyl)-N'-(2-oxoethyl)acetohydrazide;1,2-dimethyl-1-(2-methylpropyl)hydrazine.
| Compound Name | 2-bromo-N'-(2-methylpropyl)-N'-(2-oxoethyl)acetohydrazide;1,2-dimethyl-1-(2-methylpropyl)hydrazine |
|---|---|
| PubChem CID | 142215971 |
| Molecular Formula | C14H31BrN4O2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-bromo-N'-(2-methylpropyl)-N'-(2-oxoethyl)acetohydrazide;1,2-dimethyl-1-(2-methylpropyl)hydrazine |
| SMILES | CC(C)CN(CC=O)NC(=O)CBr.CNN(C)CC(C)C |
| InChI | InChI=1S/C8H15BrN2O2.C6H16N2/c1-7(2)6-11(3-4-12)10-8(13)5-9;1-6(2)5-8(4)7-3/h4,7H,3,5-6H2,1-2H3,(H,10,13);6-7H,5H2,1-4H3 |
| InChIKey | LVNYFTOWYVRZFI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|