C10H21BrN4O2 — CID 142216000
2-[[(2-bromoacetyl)amino]-methylamino]-N'-methyl-N'-(2-methylpropyl)acetohydrazide (PubChem CID 142216000) has the molecular formula C10H21BrN4O2 and a molecular weight of 309.21 g/mol. Its IUPAC name is 2-[[(2-bromoacetyl)amino]-methylamino]-N'-methyl-N'-(2-methylpropyl)acetohydrazide.
| Compound Name | 2-[[(2-bromoacetyl)amino]-methylamino]-N'-methyl-N'-(2-methylpropyl)acetohydrazide |
|---|---|
| PubChem CID | 142216000 |
| Molecular Formula | C10H21BrN4O2 |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-[[(2-bromoacetyl)amino]-methylamino]-N'-methyl-N'-(2-methylpropyl)acetohydrazide |
| SMILES | CC(C)CN(C)NC(=O)CN(C)NC(=O)CBr |
| InChI | InChI=1S/C10H21BrN4O2/c1-8(2)6-14(3)13-10(17)7-15(4)12-9(16)5-11/h8H,5-7H2,1-4H3,(H,12,16)(H,13,17) |
| InChIKey | CQCJKMTYWPYVMD-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|