C27H36N2O3 — CID 142216523
N-[(2S)-1-hydroxy-5-oxo-5-[4-[(3R)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),9,11,13-tetraenylidene]piperidin-1-yl]pentan-2-yl]acetamide (PubChem CID 142216523) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-5-oxo-5-[4-[(3R)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),9,11,13-tetraenylidene]piperidin-1-yl]pentan-2-yl]acetamide.
| Compound Name | N-[(2S)-1-hydroxy-5-oxo-5-[4-[(3R)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),9,11,13-tetraenylidene]piperidin-1-yl]pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 142216523 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | N-[(2S)-1-hydroxy-5-oxo-5-[4-[(3R)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),9,11,13-tetraenylidene]piperidin-1-yl]pentan-2-yl]acetamide |
| SMILES | CC(=O)N[C@H](CO)CCC(=O)N1CCC(=C2c3ccccc3C=CC3CCCC[C@@H]23)CC1 |
| InChI | InChI=1S/C27H36N2O3/c1-19(31)28-23(18-30)12-13-26(32)29-16-14-22(15-17-29)27-24-8-4-2-6-20(24)10-11-21-7-3-5-9-25(21)27/h2,4,6,8,10-11,21,23,25,30H,3,5,7,9,12-18H2,1H3,(H,28,31)/t21?,23-,25+/m0/s1 |
| InChIKey | XZVHOZJKTBLIAU-QRFCCWDFSA-N |
| XLogP | 4.17 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |