C33H38N2O3 — CID 142216520
N-[(2S)-2-hydroxy-1-[3-oxo-3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]propyl]cyclopropyl]cyclohexanecarboxamide (PubChem CID 142216520) has the molecular formula C33H38N2O3 and a molecular weight of 510.68 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-1-[3-oxo-3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]propyl]cyclopropyl]cyclohexanecarboxamide.
| Compound Name | N-[(2S)-2-hydroxy-1-[3-oxo-3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]propyl]cyclopropyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 142216520 |
| Molecular Formula | C33H38N2O3 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | N-[(2S)-2-hydroxy-1-[3-oxo-3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]propyl]cyclopropyl]cyclohexanecarboxamide |
| SMILES | O=C(NC1(CCC(=O)N2CCC(=C3c4ccccc4C=Cc4ccccc43)CC2)C[C@@H]1O)C1CCCCC1 |
| InChI | InChI=1S/C33H38N2O3/c36-29-22-33(29,34-32(38)26-10-2-1-3-11-26)19-16-30(37)35-20-17-25(18-21-35)31-27-12-6-4-8-23(27)14-15-24-9-5-7-13-28(24)31/h4-9,12-15,26,29,36H,1-3,10-11,16-22H2,(H,34,38)/t29-,33?/m0/s1 |
| InChIKey | VWWFXUKEYVRWLF-WXTKOERCSA-N |
| XLogP | 5.57 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|