C28H33NO4S — CID 68752009
tert-butyl 4-[5-(3-ethoxy-3-oxopropyl)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,8,10,12-hexaen-2-ylidene]piperidine-1-carboxylate (PubChem CID 68752009) has the molecular formula C28H33NO4S and a molecular weight of 479.64 g/mol. Its IUPAC name is tert-butyl 4-[5-(3-ethoxy-3-oxopropyl)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,8,10,12-hexaen-2-ylidene]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(3-ethoxy-3-oxopropyl)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,8,10,12-hexaen-2-ylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68752009 |
| Molecular Formula | C28H33NO4S |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | tert-butyl 4-[5-(3-ethoxy-3-oxopropyl)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,8,10,12-hexaen-2-ylidene]piperidine-1-carboxylate |
| SMILES | CCOC(=O)CCc1cc2c(s1)C=Cc1ccccc1C2=C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C28H33NO4S/c1-5-32-25(30)13-11-21-18-23-24(34-21)12-10-19-8-6-7-9-22(19)26(23)20-14-16-29(17-15-20)27(31)33-28(2,3)4/h6-10,12,18H,5,11,13-17H2,1-4H3 |
| InChIKey | JMJBUKRVCOFPBI-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |