C28H31NO2 — CID 178031505
6-methoxy-1-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]hept-6-en-1-one (PubChem CID 178031505) has the molecular formula C28H31NO2 and a molecular weight of 413.56 g/mol. Its IUPAC name is 6-methoxy-1-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]hept-6-en-1-one.
| Compound Name | 6-methoxy-1-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]hept-6-en-1-one |
|---|---|
| PubChem CID | 178031505 |
| Molecular Formula | C28H31NO2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 6-methoxy-1-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]hept-6-en-1-one |
| SMILES | C=C(CCCCC(=O)N1CCC(=C2c3ccccc3C=Cc3ccccc32)CC1)OC |
| InChI | InChI=1S/C28H31NO2/c1-21(31-2)9-3-8-14-27(30)29-19-17-24(18-20-29)28-25-12-6-4-10-22(25)15-16-23-11-5-7-13-26(23)28/h4-7,10-13,15-16H,1,3,8-9,14,17-20H2,2H3 |
| InChIKey | BSMQDMYHKMIIAP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|