C26H31N3O2 — CID 142216914
ethane;[(5-ethenylpiperidin-2-yl)-quinolin-4-ylmethyl] N-phenylcarbamate (PubChem CID 142216914) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is ethane;[(5-ethenylpiperidin-2-yl)-quinolin-4-ylmethyl] N-phenylcarbamate.
| Compound Name | ethane;[(5-ethenylpiperidin-2-yl)-quinolin-4-ylmethyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 142216914 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | ethane;[(5-ethenylpiperidin-2-yl)-quinolin-4-ylmethyl] N-phenylcarbamate |
| SMILES | C=CC1CCC(C(OC(=O)Nc2ccccc2)c2ccnc3ccccc23)NC1.CC |
| InChI | InChI=1S/C24H25N3O2.C2H6/c1-2-17-12-13-22(26-16-17)23(29-24(28)27-18-8-4-3-5-9-18)20-14-15-25-21-11-7-6-10-19(20)21;1-2/h2-11,14-15,17,22-23,26H,1,12-13,16H2,(H,27,28);1-2H3 |
| InChIKey | SJCWMYBATCJJIC-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|