C33H34N2O3 — CID 142216976
[(S)-[(2R,4S,5R)-4,5-diethylpiperidin-2-yl]-quinolin-4-ylmethyl] 9H-xanthene-9-carboxylate (PubChem CID 142216976) has the molecular formula C33H34N2O3 and a molecular weight of 506.65 g/mol. Its IUPAC name is [(S)-[(2R,4S,5R)-4,5-diethylpiperidin-2-yl]-quinolin-4-ylmethyl] 9H-xanthene-9-carboxylate.
| Compound Name | [(S)-[(2R,4S,5R)-4,5-diethylpiperidin-2-yl]-quinolin-4-ylmethyl] 9H-xanthene-9-carboxylate |
|---|---|
| PubChem CID | 142216976 |
| Molecular Formula | C33H34N2O3 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | [(S)-[(2R,4S,5R)-4,5-diethylpiperidin-2-yl]-quinolin-4-ylmethyl] 9H-xanthene-9-carboxylate |
| SMILES | CC[C@H]1CN[C@@H]([C@@H](OC(=O)C2c3ccccc3Oc3ccccc32)c2ccnc3ccccc23)C[C@@H]1CC |
| InChI | InChI=1S/C33H34N2O3/c1-3-21-19-28(35-20-22(21)4-2)32(24-17-18-34-27-14-8-5-11-23(24)27)38-33(36)31-25-12-6-9-15-29(25)37-30-16-10-7-13-26(30)31/h5-18,21-22,28,31-32,35H,3-4,19-20H2,1-2H3/t21-,22-,28+,32-/m0/s1 |
| InChIKey | FOTFOXKUYXXJHX-KOXSIKODSA-N |
| XLogP | 7.17 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |