C24H27BrN2 — CID 142218753
4-[[4-(bromomethyl)phenyl]-[4-(dimethylamino)cyclohexa-2,5-dien-1-ylidene]methyl]-N,N-dimethylaniline (PubChem CID 142218753) has the molecular formula C24H27BrN2 and a molecular weight of 423.40 g/mol. Its IUPAC name is 4-[[4-(bromomethyl)phenyl]-[4-(dimethylamino)cyclohexa-2,5-dien-1-ylidene]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[4-(bromomethyl)phenyl]-[4-(dimethylamino)cyclohexa-2,5-dien-1-ylidene]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 142218753 |
| Molecular Formula | C24H27BrN2 |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 4-[[4-(bromomethyl)phenyl]-[4-(dimethylamino)cyclohexa-2,5-dien-1-ylidene]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(=C2C=CC(N(C)C)C=C2)c2ccc(CBr)cc2)cc1 |
| InChI | InChI=1S/C24H27BrN2/c1-26(2)22-13-9-20(10-14-22)24(19-7-5-18(17-25)6-8-19)21-11-15-23(16-12-21)27(3)4/h5-16,22H,17H2,1-4H3/b24-20- |
| InChIKey | OKYAEGXSXHZZEI-GFMRDNFCSA-N |
| XLogP | 5.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|