C36H57F2N3O2 — CID 142220156
1-[4-[bis(4-fluorophenyl)methyl]-2-butylpiperazin-1-yl]-3-propylnonan-1-one;ethane;formamide (PubChem CID 142220156) has the molecular formula C36H57F2N3O2 and a molecular weight of 601.87 g/mol. Its IUPAC name is 1-[4-[bis(4-fluorophenyl)methyl]-2-butylpiperazin-1-yl]-3-propylnonan-1-one;ethane;formamide.
| Compound Name | 1-[4-[bis(4-fluorophenyl)methyl]-2-butylpiperazin-1-yl]-3-propylnonan-1-one;ethane;formamide |
|---|---|
| PubChem CID | 142220156 |
| Molecular Formula | C36H57F2N3O2 |
| Molecular Weight | 601.87 g/mol |
| Exact Mass | 601.44 |
| IUPAC Name | 1-[4-[bis(4-fluorophenyl)methyl]-2-butylpiperazin-1-yl]-3-propylnonan-1-one;ethane;formamide |
| SMILES | CC.CCCCCCC(CCC)CC(=O)N1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1CCCC.NC=O |
| InChI | InChI=1S/C33H48F2N2O.C2H6.CH3NO/c1-4-7-9-10-12-26(11-6-3)24-32(38)37-23-22-36(25-31(37)13-8-5-2)33(27-14-18-29(34)19-15-27)28-16-20-30(35)21-17-28;1-2;2-1-3/h14-21,26,31,33H,4-13,22-25H2,1-3H3;1-2H3;1H,(H2,2,3) |
| InChIKey | ZFRKDDBPZZMVHQ-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.87 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|