C23H28ClFN2O2 — CID 57123213
1-[(2S)-2-butyl-4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-(4-chlorophenoxy)ethanone (PubChem CID 57123213) has the molecular formula C23H28ClFN2O2 and a molecular weight of 418.94 g/mol. Its IUPAC name is 1-[(2S)-2-butyl-4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-(4-chlorophenoxy)ethanone.
| Compound Name | 1-[(2S)-2-butyl-4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-(4-chlorophenoxy)ethanone |
|---|---|
| PubChem CID | 57123213 |
| Molecular Formula | C23H28ClFN2O2 |
| Molecular Weight | 418.94 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-[(2S)-2-butyl-4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-(4-chlorophenoxy)ethanone |
| SMILES | CCCC[C@H]1CN(Cc2ccc(F)cc2)CCN1C(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H28ClFN2O2/c1-2-3-4-21-16-26(15-18-5-9-20(25)10-6-18)13-14-27(21)23(28)17-29-22-11-7-19(24)8-12-22/h5-12,21H,2-4,13-17H2,1H3/t21-/m0/s1 |
| InChIKey | AOVYKMJWKHOYFZ-NRFANRHFSA-N |
| XLogP | 4.76 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.94 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |