C22H24ClFN2O — CID 141088330
(E)-3-(4-chlorophenyl)-1-[(2R)-2-ethyl-4-[(4-fluorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 141088330) has the molecular formula C22H24ClFN2O and a molecular weight of 386.90 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-[(2R)-2-ethyl-4-[(4-fluorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-[(2R)-2-ethyl-4-[(4-fluorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 141088330 |
| Molecular Formula | C22H24ClFN2O |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-[(2R)-2-ethyl-4-[(4-fluorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | CC[C@@H]1CN(Cc2ccc(F)cc2)CCN1C(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H24ClFN2O/c1-2-21-16-25(15-18-5-10-20(24)11-6-18)13-14-26(21)22(27)12-7-17-3-8-19(23)9-4-17/h3-12,21H,2,13-16H2,1H3/b12-7+/t21-/m1/s1 |
| InChIKey | ZLHFWVJOCMDTQR-JYNAJPCDSA-N |
| XLogP | 4.62 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|