C22H26ClFN2O5S — CID 22268136
[5-chloro-2-[2-[2-ethyl-4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]phenyl]methanesulfonic acid (PubChem CID 22268136) has the molecular formula C22H26ClFN2O5S and a molecular weight of 484.98 g/mol. Its IUPAC name is [5-chloro-2-[2-[2-ethyl-4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]phenyl]methanesulfonic acid.
| Compound Name | [5-chloro-2-[2-[2-ethyl-4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 22268136 |
| Molecular Formula | C22H26ClFN2O5S |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | [5-chloro-2-[2-[2-ethyl-4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]phenyl]methanesulfonic acid |
| SMILES | CCC1CN(Cc2ccc(F)cc2)CCN1C(=O)COc1ccc(Cl)cc1CS(=O)(=O)O |
| InChI | InChI=1S/C22H26ClFN2O5S/c1-2-20-13-25(12-16-3-6-19(24)7-4-16)9-10-26(20)22(27)14-31-21-8-5-18(23)11-17(21)15-32(28,29)30/h3-8,11,20H,2,9-10,12-15H2,1H3,(H,28,29,30) |
| InChIKey | FOGJDLMHPLVIQV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|