C20H22ClFN2O5S — CID 11775459
5-chloro-2-[2-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-oxoethoxy]benzenesulfonic acid (PubChem CID 11775459) has the molecular formula C20H22ClFN2O5S and a molecular weight of 456.92 g/mol. Its IUPAC name is 5-chloro-2-[2-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-oxoethoxy]benzenesulfonic acid.
| Compound Name | 5-chloro-2-[2-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-oxoethoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 11775459 |
| Molecular Formula | C20H22ClFN2O5S |
| Molecular Weight | 456.92 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 5-chloro-2-[2-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-oxoethoxy]benzenesulfonic acid |
| SMILES | C[C@@H]1CN(Cc2ccc(F)cc2)CCN1C(=O)COc1ccc(Cl)cc1S(=O)(=O)O |
| InChI | InChI=1S/C20H22ClFN2O5S/c1-14-11-23(12-15-2-5-17(22)6-3-15)8-9-24(14)20(25)13-29-18-7-4-16(21)10-19(18)30(26,27)28/h2-7,10,14H,8-9,11-13H2,1H3,(H,26,27,28)/t14-/m1/s1 |
| InChIKey | PBHIWOUABFDZGC-CQSZACIVSA-N |
| XLogP | 2.84 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.92 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|