C21H24BrFN2O5S — CID 22268159
[5-bromo-2-[2-[4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-oxoethoxy]phenyl]methanesulfonic acid (PubChem CID 22268159) has the molecular formula C21H24BrFN2O5S and a molecular weight of 515.40 g/mol. Its IUPAC name is [5-bromo-2-[2-[4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-oxoethoxy]phenyl]methanesulfonic acid.
| Compound Name | [5-bromo-2-[2-[4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-oxoethoxy]phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 22268159 |
| Molecular Formula | C21H24BrFN2O5S |
| Molecular Weight | 515.40 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | [5-bromo-2-[2-[4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-oxoethoxy]phenyl]methanesulfonic acid |
| SMILES | CC1CN(Cc2ccc(F)cc2)CCN1C(=O)COc1ccc(Br)cc1CS(=O)(=O)O |
| InChI | InChI=1S/C21H24BrFN2O5S/c1-15-11-24(12-16-2-5-19(23)6-3-16)8-9-25(15)21(26)13-30-20-7-4-18(22)10-17(20)14-31(27,28)29/h2-7,10,15H,8-9,11-14H2,1H3,(H,27,28,29) |
| InChIKey | XSZZHSBIEJXDNP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|