C22H26Cl2N2O5S — CID 10164006
2-[5-chloro-2-[2-[(2R)-4-[(4-chlorophenyl)methyl]-2-methylpiperazin-1-yl]-2-oxoethoxy]phenyl]ethanesulfonic acid (PubChem CID 10164006) has the molecular formula C22H26Cl2N2O5S and a molecular weight of 501.43 g/mol. Its IUPAC name is 2-[5-chloro-2-[2-[(2R)-4-[(4-chlorophenyl)methyl]-2-methylpiperazin-1-yl]-2-oxoethoxy]phenyl]ethanesulfonic acid.
| Compound Name | 2-[5-chloro-2-[2-[(2R)-4-[(4-chlorophenyl)methyl]-2-methylpiperazin-1-yl]-2-oxoethoxy]phenyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 10164006 |
| Molecular Formula | C22H26Cl2N2O5S |
| Molecular Weight | 501.43 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | 2-[5-chloro-2-[2-[(2R)-4-[(4-chlorophenyl)methyl]-2-methylpiperazin-1-yl]-2-oxoethoxy]phenyl]ethanesulfonic acid |
| SMILES | C[C@@H]1CN(Cc2ccc(Cl)cc2)CCN1C(=O)COc1ccc(Cl)cc1CCS(=O)(=O)O |
| InChI | InChI=1S/C22H26Cl2N2O5S/c1-16-13-25(14-17-2-4-19(23)5-3-17)9-10-26(16)22(27)15-31-21-7-6-20(24)12-18(21)8-11-32(28,29)30/h2-7,12,16H,8-11,13-15H2,1H3,(H,28,29,30)/t16-/m1/s1 |
| InChIKey | PAXVZZUONUBUPS-MRXNPFEDSA-N |
| XLogP | 3.54 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|