C23H28ClFN2O5S — CID 10300543
2-[5-chloro-2-[2-[(2R)-2-ethyl-4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]phenyl]ethanesulfonic acid (PubChem CID 10300543) has the molecular formula C23H28ClFN2O5S and a molecular weight of 499.00 g/mol. Its IUPAC name is 2-[5-chloro-2-[2-[(2R)-2-ethyl-4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]phenyl]ethanesulfonic acid.
| Compound Name | 2-[5-chloro-2-[2-[(2R)-2-ethyl-4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]phenyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 10300543 |
| Molecular Formula | C23H28ClFN2O5S |
| Molecular Weight | 499.00 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 2-[5-chloro-2-[2-[(2R)-2-ethyl-4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]phenyl]ethanesulfonic acid |
| SMILES | CC[C@@H]1CN(Cc2ccc(F)cc2)CCN1C(=O)COc1ccc(Cl)cc1CCS(=O)(=O)O |
| InChI | InChI=1S/C23H28ClFN2O5S/c1-2-21-15-26(14-17-3-6-20(25)7-4-17)10-11-27(21)23(28)16-32-22-8-5-19(24)13-18(22)9-12-33(29,30)31/h3-8,13,21H,2,9-12,14-16H2,1H3,(H,29,30,31)/t21-/m1/s1 |
| InChIKey | IWMGJPOYBLSWNP-OAQYLSRUSA-N |
| XLogP | 3.41 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.00 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|