C23H25ClFN5O2S — CID 18768101
methyl N-[5-chloro-2-[2-[4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-oxoethoxy]phenyl]-N-cyanocarbamimidothioate (PubChem CID 18768101) has the molecular formula C23H25ClFN5O2S and a molecular weight of 490.00 g/mol. Its IUPAC name is methyl N-[5-chloro-2-[2-[4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-oxoethoxy]phenyl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N-[5-chloro-2-[2-[4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-oxoethoxy]phenyl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 18768101 |
| Molecular Formula | C23H25ClFN5O2S |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | methyl N-[5-chloro-2-[2-[4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-2-oxoethoxy]phenyl]-N-cyanocarbamimidothioate |
| SMILES | [H]/N=C(\SC)N(C#N)c1cc(Cl)ccc1OCC(=O)N1CCN(Cc2ccc(F)cc2)CC1C |
| InChI | InChI=1S/C23H25ClFN5O2S/c1-16-12-28(13-17-3-6-19(25)7-4-17)9-10-29(16)22(31)14-32-21-8-5-18(24)11-20(21)30(15-26)23(27)33-2/h3-8,11,16,27H,9-10,12-14H2,1-2H3/b27-23- |
| InChIKey | YGGFXZKYRHQWKW-VYIQYICTSA-N |
| XLogP | 4.18 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|