C20H30FN3O2 — CID 88694308
4-(4-fluorophenyl)-2-(4-oxobutyl)-N-pentylpiperazine-1-carboxamide (PubChem CID 88694308) has the molecular formula C20H30FN3O2 and a molecular weight of 363.48 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-(4-oxobutyl)-N-pentylpiperazine-1-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-2-(4-oxobutyl)-N-pentylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 88694308 |
| Molecular Formula | C20H30FN3O2 |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 4-(4-fluorophenyl)-2-(4-oxobutyl)-N-pentylpiperazine-1-carboxamide |
| SMILES | CCCCCNC(=O)N1CCN(c2ccc(F)cc2)CC1CCCC=O |
| InChI | InChI=1S/C20H30FN3O2/c1-2-3-5-12-22-20(26)24-14-13-23(16-19(24)7-4-6-15-25)18-10-8-17(21)9-11-18/h8-11,15,19H,2-7,12-14,16H2,1H3,(H,22,26) |
| InChIKey | PDXXETKRRWUKDM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|