C21H29NO4 — CID 142221394
methyl 4-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-(methyliminomethyl)cyclohexane-1-carboxylate (PubChem CID 142221394) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is methyl 4-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-(methyliminomethyl)cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-(methyliminomethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 142221394 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | methyl 4-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-4-(methyliminomethyl)cyclohexane-1-carboxylate |
| SMILES | C/N=C/C1(c2ccc(OC)c(OCC3CC3)c2)CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C21H29NO4/c1-22-14-21(10-8-16(9-11-21)20(23)25-3)17-6-7-18(24-2)19(12-17)26-13-15-4-5-15/h6-7,12,14-16H,4-5,8-11,13H2,1-3H3/b22-14+ |
| InChIKey | VGFLLWLCNQIKSL-HYARGMPZSA-N |
| XLogP | 3.79 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|