C16H20O4 — CID 175072908
[2-methoxy-5-[1-(methoxymethyl)cyclopropyl]phenyl] cyclopropanecarboxylate (PubChem CID 175072908) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is [2-methoxy-5-[1-(methoxymethyl)cyclopropyl]phenyl] cyclopropanecarboxylate.
| Compound Name | [2-methoxy-5-[1-(methoxymethyl)cyclopropyl]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 175072908 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | [2-methoxy-5-[1-(methoxymethyl)cyclopropyl]phenyl] cyclopropanecarboxylate |
| SMILES | COCC1(c2ccc(OC)c(OC(=O)C3CC3)c2)CC1 |
| InChI | InChI=1S/C16H20O4/c1-18-10-16(7-8-16)12-5-6-13(19-2)14(9-12)20-15(17)11-3-4-11/h5-6,9,11H,3-4,7-8,10H2,1-2H3 |
| InChIKey | TYNYBAMXGKSFRB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|