C20H23NO4 — CID 163457573
[5-[2-(2,6-dimethyl-4-oxo-1-pyridinyl)ethyl]-2-methoxyphenyl] cyclopropanecarboxylate (PubChem CID 163457573) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is [5-[2-(2,6-dimethyl-4-oxo-1-pyridinyl)ethyl]-2-methoxyphenyl] cyclopropanecarboxylate.
| Compound Name | [5-[2-(2,6-dimethyl-4-oxo-1-pyridinyl)ethyl]-2-methoxyphenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 163457573 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [5-[2-(2,6-dimethyl-4-oxo-1-pyridinyl)ethyl]-2-methoxyphenyl] cyclopropanecarboxylate |
| SMILES | COc1ccc(CCn2c(C)cc(=O)cc2C)cc1OC(=O)C1CC1 |
| InChI | InChI=1S/C20H23NO4/c1-13-10-17(22)11-14(2)21(13)9-8-15-4-7-18(24-3)19(12-15)25-20(23)16-5-6-16/h4,7,10-12,16H,5-6,8-9H2,1-3H3 |
| InChIKey | BLTXKFGREAELHD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|