C17H20N4O4 — CID 142223686
3,4-diamino-N-[4-(ethylcarbamoyl)phenyl]benzamide;formic acid (PubChem CID 142223686) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 3,4-diamino-N-[4-(ethylcarbamoyl)phenyl]benzamide;formic acid.
| Compound Name | 3,4-diamino-N-[4-(ethylcarbamoyl)phenyl]benzamide;formic acid |
|---|---|
| PubChem CID | 142223686 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3,4-diamino-N-[4-(ethylcarbamoyl)phenyl]benzamide;formic acid |
| SMILES | CCNC(=O)c1ccc(NC(=O)c2ccc(N)c(N)c2)cc1.O=CO |
| InChI | InChI=1S/C16H18N4O2.CH2O2/c1-2-19-15(21)10-3-6-12(7-4-10)20-16(22)11-5-8-13(17)14(18)9-11;2-1-3/h3-9H,2,17-18H2,1H3,(H,19,21)(H,20,22);1H,(H,2,3) |
| InChIKey | APPOROASXBGRRN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|