C5H10N4O — CID 142223895
5-methoxy-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142223895) has the molecular formula C5H10N4O and a molecular weight of 142.16 g/mol. Its IUPAC name is 5-methoxy-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-methoxy-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142223895 |
| Molecular Formula | C5H10N4O |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 5-methoxy-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCC(OC)=N1 |
| InChI | InChI=1S/C5H10N4O/c1-10-4-2-3-9(8-4)5(6)7/h2-3H2,1H3,(H3,6,7) |
| InChIKey | FUZSVEYXAXIWIP-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 74.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|