C12H18N2 — CID 142224867
1-N'-cyclohepta-1,4,6-trien-1-yl-1-N-prop-2-enylethane-1,1-diamine (PubChem CID 142224867) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-N'-cyclohepta-1,4,6-trien-1-yl-1-N-prop-2-enylethane-1,1-diamine.
| Compound Name | 1-N'-cyclohepta-1,4,6-trien-1-yl-1-N-prop-2-enylethane-1,1-diamine |
|---|---|
| PubChem CID | 142224867 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1-N'-cyclohepta-1,4,6-trien-1-yl-1-N-prop-2-enylethane-1,1-diamine |
| SMILES | C=CCNC(C)NC1=CCC=CC=C1 |
| InChI | InChI=1S/C12H18N2/c1-3-10-13-11(2)14-12-8-6-4-5-7-9-12/h3-6,8-9,11,13-14H,1,7,10H2,2H3 |
| InChIKey | QVNASVTWNIHNPJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|