C28H33N3O2 — CID 142225332
2-(cyclohexa-1,5-dien-1-ylamino)-6,7-dimethyl-1-phenyl-1,8-naphthyridin-4-one;prop-1-ene;(E)-prop-1-en-1-ol (PubChem CID 142225332) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 2-(cyclohexa-1,5-dien-1-ylamino)-6,7-dimethyl-1-phenyl-1,8-naphthyridin-4-one;prop-1-ene;(E)-prop-1-en-1-ol.
| Compound Name | 2-(cyclohexa-1,5-dien-1-ylamino)-6,7-dimethyl-1-phenyl-1,8-naphthyridin-4-one;prop-1-ene;(E)-prop-1-en-1-ol |
|---|---|
| PubChem CID | 142225332 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 2-(cyclohexa-1,5-dien-1-ylamino)-6,7-dimethyl-1-phenyl-1,8-naphthyridin-4-one;prop-1-ene;(E)-prop-1-en-1-ol |
| SMILES | C/C=C/O.C=CC.Cc1cc2c(=O)cc(NC3=CCCC=C3)n(-c3ccccc3)c2nc1C |
| InChI | InChI=1S/C22H21N3O.C3H6O.C3H6/c1-15-13-19-20(26)14-21(24-17-9-5-3-6-10-17)25(22(19)23-16(15)2)18-11-7-4-8-12-18;1-2-3-4;1-3-2/h4-5,7-14,24H,3,6H2,1-2H3;2-4H,1H3;3H,1H2,2H3/b;3-2+; |
| InChIKey | TWXIYMCZKOHBPK-VQSZBRBVSA-N |
| XLogP | 6.92 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|