About 7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine
7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine (PubChem CID 142226705) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine.
Analyze 7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine?
The IUPAC name of 7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine (CID 142226705) is 7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine.
What is the SMILES notation for 7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine?
The canonical SMILES for 7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine is CC1C=Nc2c(N)ncnc2CC1.
What is the InChIKey of 7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine?
The InChIKey is NLTUXFDITMACFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-6-2-3-7-8(11-4-6)9(10)13-5-12-7/h4-6H,2-3H2,1H3,(H2,10,12,13).
What are the key properties of 7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine?
7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine has a molecular weight of 176.22 g/mol, XLogP of 1.34, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-8,9-dihydro-7H-pyrimido[5,4-b]azepin-4-amine is sourced from PubChem (CID 142226705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).