C28H33N5O — CID 142228271
(E)-N-[2-[[4-(dimethylamino)quinazolin-2-yl]amino]spiro[2.5]octan-6-yl]-2-methyl-3-phenylprop-2-enamide (PubChem CID 142228271) has the molecular formula C28H33N5O and a molecular weight of 455.61 g/mol. Its IUPAC name is (E)-N-[2-[[4-(dimethylamino)quinazolin-2-yl]amino]spiro[2.5]octan-6-yl]-2-methyl-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[[4-(dimethylamino)quinazolin-2-yl]amino]spiro[2.5]octan-6-yl]-2-methyl-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 142228271 |
| Molecular Formula | C28H33N5O |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | (E)-N-[2-[[4-(dimethylamino)quinazolin-2-yl]amino]spiro[2.5]octan-6-yl]-2-methyl-3-phenylprop-2-enamide |
| SMILES | C/C(=C\c1ccccc1)C(=O)NC1CCC2(CC1)CC2Nc1nc(N(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C28H33N5O/c1-19(17-20-9-5-4-6-10-20)26(34)29-21-13-15-28(16-14-21)18-24(28)31-27-30-23-12-8-7-11-22(23)25(32-27)33(2)3/h4-12,17,21,24H,13-16,18H2,1-3H3,(H,29,34)(H,30,31,32)/b19-17+ |
| InChIKey | IECMKHNAYINPJO-HTXNQAPBSA-N |
| XLogP | 5.03 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|