C13H27N3 — CID 142230784
N,N-dimethyl-N'-[[(4-propylcyclohexyl)amino]methyl]methanimidamide (PubChem CID 142230784) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is N,N-dimethyl-N'-[[(4-propylcyclohexyl)amino]methyl]methanimidamide.
| Compound Name | N,N-dimethyl-N'-[[(4-propylcyclohexyl)amino]methyl]methanimidamide |
|---|---|
| PubChem CID | 142230784 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | N,N-dimethyl-N'-[[(4-propylcyclohexyl)amino]methyl]methanimidamide |
| SMILES | CCCC1CCC(NC/N=C/N(C)C)CC1 |
| InChI | InChI=1S/C13H27N3/c1-4-5-12-6-8-13(9-7-12)15-10-14-11-16(2)3/h11-13,15H,4-10H2,1-3H3/b14-11+ |
| InChIKey | BMQUNKMVKPNMPL-SDNWHVSQSA-N |
| XLogP | 2.48 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|