C35H42N6O4 — CID 142233362
N-benzyl-4-[(2S,4E)-8-hydroxy-4-methyl-1-oxodeca-4,6,9-trien-2-yl]-1-methyl-3-[[methyl(quinolin-8-ylmethyl)amino]methyl]-5-oxo-1,2,4-triazinane-2-carboxamide (PubChem CID 142233362) has the molecular formula C35H42N6O4 and a molecular weight of 610.76 g/mol. Its IUPAC name is N-benzyl-4-[(2S,4E)-8-hydroxy-4-methyl-1-oxodeca-4,6,9-trien-2-yl]-1-methyl-3-[[methyl(quinolin-8-ylmethyl)amino]methyl]-5-oxo-1,2,4-triazinane-2-carboxamide.
| Compound Name | N-benzyl-4-[(2S,4E)-8-hydroxy-4-methyl-1-oxodeca-4,6,9-trien-2-yl]-1-methyl-3-[[methyl(quinolin-8-ylmethyl)amino]methyl]-5-oxo-1,2,4-triazinane-2-carboxamide |
|---|---|
| PubChem CID | 142233362 |
| Molecular Formula | C35H42N6O4 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | N-benzyl-4-[(2S,4E)-8-hydroxy-4-methyl-1-oxodeca-4,6,9-trien-2-yl]-1-methyl-3-[[methyl(quinolin-8-ylmethyl)amino]methyl]-5-oxo-1,2,4-triazinane-2-carboxamide |
| SMILES | C=CC(O)C=C/C=C(\C)C[C@@H](C=O)N1C(=O)CN(C)N(C(=O)NCc2ccccc2)C1CN(C)Cc1cccc2cccnc12 |
| InChI | InChI=1S/C35H42N6O4/c1-5-31(43)18-9-12-26(2)20-30(25-42)40-32(23-38(3)22-29-16-10-15-28-17-11-19-36-34(28)29)41(39(4)24-33(40)44)35(45)37-21-27-13-7-6-8-14-27/h5-19,25,30-32,43H,1,20-24H2,2-4H3,(H,37,45)/b18-9?,26-12+/t30-,31?,32?/m0/s1 |
| InChIKey | ZMNDYCAUNWINSU-DMXRHIBMSA-N |
| XLogP | 3.90 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|