C25H43N5O4 — CID 143145708
acetaldehyde;N-benzyl-3-[[3-butoxypropyl(methyl)amino]methyl]-4-ethyl-1-methyl-5-oxo-1,2,4-triazinane-2-carboxamide (PubChem CID 143145708) has the molecular formula C25H43N5O4 and a molecular weight of 477.65 g/mol. Its IUPAC name is acetaldehyde;N-benzyl-3-[[3-butoxypropyl(methyl)amino]methyl]-4-ethyl-1-methyl-5-oxo-1,2,4-triazinane-2-carboxamide.
| Compound Name | acetaldehyde;N-benzyl-3-[[3-butoxypropyl(methyl)amino]methyl]-4-ethyl-1-methyl-5-oxo-1,2,4-triazinane-2-carboxamide |
|---|---|
| PubChem CID | 143145708 |
| Molecular Formula | C25H43N5O4 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.33 |
| IUPAC Name | acetaldehyde;N-benzyl-3-[[3-butoxypropyl(methyl)amino]methyl]-4-ethyl-1-methyl-5-oxo-1,2,4-triazinane-2-carboxamide |
| SMILES | CC=O.CCCCOCCCN(C)CC1N(CC)C(=O)CN(C)N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H39N5O3.C2H4O/c1-5-7-15-31-16-11-14-25(3)18-21-27(6-2)22(29)19-26(4)28(21)23(30)24-17-20-12-9-8-10-13-20;1-2-3/h8-10,12-13,21H,5-7,11,14-19H2,1-4H3,(H,24,30);2H,1H3 |
| InChIKey | WVBGXLJAEBNHJT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|