C13H16O — CID 142234797
1-(5-methyl-2,3-dihydro-1H-azulen-5-yl)ethanone (PubChem CID 142234797) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-(5-methyl-2,3-dihydro-1H-azulen-5-yl)ethanone.
| Compound Name | 1-(5-methyl-2,3-dihydro-1H-azulen-5-yl)ethanone |
|---|---|
| PubChem CID | 142234797 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 1-(5-methyl-2,3-dihydro-1H-azulen-5-yl)ethanone |
| SMILES | CC(=O)C1(C)C=CC=C2CCCC2=C1 |
| InChI | InChI=1S/C13H16O/c1-10(14)13(2)8-4-7-11-5-3-6-12(11)9-13/h4,7-9H,3,5-6H2,1-2H3 |
| InChIKey | KPVMZBAIQPKTOV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |