C11H12N2O2 — CID 143019432
5-methyl-2-oxo-1,3-dihydrocyclohepta[b]pyrrole-5-carboxamide (PubChem CID 143019432) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 5-methyl-2-oxo-1,3-dihydrocyclohepta[b]pyrrole-5-carboxamide.
| Compound Name | 5-methyl-2-oxo-1,3-dihydrocyclohepta[b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 143019432 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 5-methyl-2-oxo-1,3-dihydrocyclohepta[b]pyrrole-5-carboxamide |
| SMILES | CC1(C(N)=O)C=CC=C2NC(=O)CC2=C1 |
| InChI | InChI=1S/C11H12N2O2/c1-11(10(12)15)4-2-3-8-7(6-11)5-9(14)13-8/h2-4,6H,5H2,1H3,(H2,12,15)(H,13,14) |
| InChIKey | PIIKILHPFQVSOR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |