C8H11NO — CID 142303542
molecular hydrogen;1,3,5,6-tetrahydroindol-2-one (PubChem CID 142303542) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is molecular hydrogen;1,3,5,6-tetrahydroindol-2-one.
| Compound Name | molecular hydrogen;1,3,5,6-tetrahydroindol-2-one |
|---|---|
| PubChem CID | 142303542 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | molecular hydrogen;1,3,5,6-tetrahydroindol-2-one |
| SMILES | O=C1CC2=CCCC=C2N1.[H][H] |
| InChI | InChI=1S/C8H9NO.H2/c10-8-5-6-3-1-2-4-7(6)9-8;/h3-4H,1-2,5H2,(H,9,10);1H |
| InChIKey | YRVOLKGACOEZDQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |