molecular hydrogen;1,3,5,6-tetrahydroindol-2-one

C8H11NO — CID 142303542

IUPACmolecular hydrogen;1,3,5,6-tetrahydroindol-2-one
SMILESO=C1CC2=CCCC=C2N1.[H][H]
InChIInChI=1S/C8H9NO.H2/c10-8-5-6-3-1-2-4-7(6)9-8;/h3-4H,1-2,5H2,(H,9,10);1H
InChIKeyYRVOLKGACOEZDQ-UHFFFAOYSA-N
MW137.18 g/mol
LogP1.36
Rot. Bonds

About molecular hydrogen;1,3,5,6-tetrahydroindol-2-one

molecular hydrogen;1,3,5,6-tetrahydroindol-2-one (PubChem CID 142303542) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is molecular hydrogen;1,3,5,6-tetrahydroindol-2-one.

Molecular Properties

Compound Namemolecular hydrogen;1,3,5,6-tetrahydroindol-2-one
PubChem CID142303542
Molecular FormulaC8H11NO
Molecular Weight137.18 g/mol
Exact Mass137.08
IUPAC Namemolecular hydrogen;1,3,5,6-tetrahydroindol-2-one
SMILESO=C1CC2=CCCC=C2N1.[H][H]
InChIInChI=1S/C8H9NO.H2/c10-8-5-6-3-1-2-4-7(6)9-8;/h3-4H,1-2,5H2,(H,9,10);1H
InChIKeyYRVOLKGACOEZDQ-UHFFFAOYSA-N
XLogP1.36
TPSA29.10 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500137.18
LogP ≤ 51.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze molecular hydrogen;1,3,5,6-tetrahydroindol-2-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;1,3,5,6-tetrahydroindol-2-one?
The IUPAC name of molecular hydrogen;1,3,5,6-tetrahydroindol-2-one (CID 142303542) is molecular hydrogen;1,3,5,6-tetrahydroindol-2-one.
What is the SMILES notation for molecular hydrogen;1,3,5,6-tetrahydroindol-2-one?
The canonical SMILES for molecular hydrogen;1,3,5,6-tetrahydroindol-2-one is O=C1CC2=CCCC=C2N1.[H][H].
What is the InChIKey of molecular hydrogen;1,3,5,6-tetrahydroindol-2-one?
The InChIKey is YRVOLKGACOEZDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.H2/c10-8-5-6-3-1-2-4-7(6)9-8;/h3-4H,1-2,5H2,(H,9,10);1H.
What are the key properties of molecular hydrogen;1,3,5,6-tetrahydroindol-2-one?
molecular hydrogen;1,3,5,6-tetrahydroindol-2-one has a molecular weight of 137.18 g/mol, XLogP of 1.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;1,3,5,6-tetrahydroindol-2-one is sourced from PubChem (CID 142303542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).