C23H32N2O4 — CID 142235172
ethane;4-[2-[6-methoxy-4-[(2E)-penta-2,4-dien-2-yl]oxyquinolin-7-yl]oxyethyl]morpholine (PubChem CID 142235172) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is ethane;4-[2-[6-methoxy-4-[(2E)-penta-2,4-dien-2-yl]oxyquinolin-7-yl]oxyethyl]morpholine.
| Compound Name | ethane;4-[2-[6-methoxy-4-[(2E)-penta-2,4-dien-2-yl]oxyquinolin-7-yl]oxyethyl]morpholine |
|---|---|
| PubChem CID | 142235172 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | ethane;4-[2-[6-methoxy-4-[(2E)-penta-2,4-dien-2-yl]oxyquinolin-7-yl]oxyethyl]morpholine |
| SMILES | C=C/C=C(\C)Oc1ccnc2cc(OCCN3CCOCC3)c(OC)cc12.CC |
| InChI | InChI=1S/C21H26N2O4.C2H6/c1-4-5-16(2)27-19-6-7-22-18-15-21(20(24-3)14-17(18)19)26-13-10-23-8-11-25-12-9-23;1-2/h4-7,14-15H,1,8-13H2,2-3H3;1-2H3/b16-5+; |
| InChIKey | LEXHBEULIRHMPW-SYRJXDITSA-N |
| XLogP | 4.45 |
| TPSA | 53.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|