C17H28 — CID 142235417
4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene;ethane (PubChem CID 142235417) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is 4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene;ethane.
| Compound Name | 4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene;ethane |
|---|---|
| PubChem CID | 142235417 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene;ethane |
| SMILES | CC.CCc1ccc(C(C)(C)C)c2c1CCC2 |
| InChI | InChI=1S/C15H22.C2H6/c1-5-11-9-10-14(15(2,3)4)13-8-6-7-12(11)13;1-2/h9-10H,5-8H2,1-4H3;1-2H3 |
| InChIKey | PSNOINDAXQTILC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |