C28H36N6O2 — CID 142238854
4-(dimethylamino)-6-methyl-8-(4-methylpiperazin-1-yl)-N-(4-morpholin-4-ylphenyl)quinoline-2-carboxamide (PubChem CID 142238854) has the molecular formula C28H36N6O2 and a molecular weight of 488.64 g/mol. Its IUPAC name is 4-(dimethylamino)-6-methyl-8-(4-methylpiperazin-1-yl)-N-(4-morpholin-4-ylphenyl)quinoline-2-carboxamide.
| Compound Name | 4-(dimethylamino)-6-methyl-8-(4-methylpiperazin-1-yl)-N-(4-morpholin-4-ylphenyl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 142238854 |
| Molecular Formula | C28H36N6O2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 4-(dimethylamino)-6-methyl-8-(4-methylpiperazin-1-yl)-N-(4-morpholin-4-ylphenyl)quinoline-2-carboxamide |
| SMILES | Cc1cc(N2CCN(C)CC2)c2nc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc(N(C)C)c2c1 |
| InChI | InChI=1S/C28H36N6O2/c1-20-17-23-25(31(2)3)19-24(30-27(23)26(18-20)34-11-9-32(4)10-12-34)28(35)29-21-5-7-22(8-6-21)33-13-15-36-16-14-33/h5-8,17-19H,9-16H2,1-4H3,(H,29,35) |
| InChIKey | MUZBNJWQJOKCGZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|