C21H23NO3S2 — CID 142239140
2-[4-[C-[(E)-1-(4-methoxyphenyl)prop-1-enyl]sulfanylcarbonimidoyl]phenyl]sulfanyl-2-methylpropanoic acid (PubChem CID 142239140) has the molecular formula C21H23NO3S2 and a molecular weight of 401.55 g/mol. Its IUPAC name is 2-[4-[C-[(E)-1-(4-methoxyphenyl)prop-1-enyl]sulfanylcarbonimidoyl]phenyl]sulfanyl-2-methylpropanoic acid.
| Compound Name | 2-[4-[C-[(E)-1-(4-methoxyphenyl)prop-1-enyl]sulfanylcarbonimidoyl]phenyl]sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 142239140 |
| Molecular Formula | C21H23NO3S2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 2-[4-[C-[(E)-1-(4-methoxyphenyl)prop-1-enyl]sulfanylcarbonimidoyl]phenyl]sulfanyl-2-methylpropanoic acid |
| SMILES | [H]/N=C(\S/C(=C/C)c1ccc(OC)cc1)c1ccc(SC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C21H23NO3S2/c1-5-18(14-6-10-16(25-4)11-7-14)26-19(22)15-8-12-17(13-9-15)27-21(2,3)20(23)24/h5-13,22H,1-4H3,(H,23,24)/b18-5+,22-19- |
| InChIKey | XNEGOZDYQAZASV-CGPMBWNSSA-N |
| XLogP | 5.77 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|