About N'-[2-(benzylamino)phenyl]methanimidamide;ethane;molecular hydrogen
N'-[2-(benzylamino)phenyl]methanimidamide;ethane;molecular hydrogen (PubChem CID 142239189) has the molecular formula C18H29N3
and a molecular weight of 287.45 g/mol. Its IUPAC name is N'-[2-(benzylamino)phenyl]methanimidamide;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | N'-[2-(benzylamino)phenyl]methanimidamide;ethane;molecular hydrogen |
| PubChem CID | 142239189 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | N'-[2-(benzylamino)phenyl]methanimidamide;ethane;molecular hydrogen |
| SMILES | CC.CC.N/C=N/c1ccccc1NCc1ccccc1.[H][H] |
| InChI | InChI=1S/C14H15N3.2C2H6.H2/c15-11-17-14-9-5-4-8-13(14)16-10-12-6-2-1-3-7-12;2*1-2;/h1-9,11,16H,10H2,(H2,15,17);2*1-2H3;1H |
| InChIKey | LMPTXKHXGXYJFT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(benzylamino)phenyl]methanimidamide;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(benzylamino)phenyl]methanimidamide;ethane;molecular hydrogen?
The IUPAC name of N'-[2-(benzylamino)phenyl]methanimidamide;ethane;molecular hydrogen (CID 142239189) is N'-[2-(benzylamino)phenyl]methanimidamide;ethane;molecular hydrogen.
What is the SMILES notation for N'-[2-(benzylamino)phenyl]methanimidamide;ethane;molecular hydrogen?
The canonical SMILES for N'-[2-(benzylamino)phenyl]methanimidamide;ethane;molecular hydrogen is CC.CC.N/C=N/c1ccccc1NCc1ccccc1.[H][H].
What is the InChIKey of N'-[2-(benzylamino)phenyl]methanimidamide;ethane;molecular hydrogen?
The InChIKey is LMPTXKHXGXYJFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3.2C2H6.H2/c15-11-17-14-9-5-4-8-13(14)16-10-12-6-2-1-3-7-12;2*1-2;/h1-9,11,16H,10H2,(H2,15,17);2*1-2H3;1H.
What are the key properties of N'-[2-(benzylamino)phenyl]methanimidamide;ethane;molecular hydrogen?
N'-[2-(benzylamino)phenyl]methanimidamide;ethane;molecular hydrogen has a molecular weight of 287.45 g/mol, XLogP of 5.22, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(benzylamino)phenyl]methanimidamide;ethane;molecular hydrogen is sourced from PubChem (CID 142239189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).