C19H18N2O4S — CID 14223944
2-[(4-ethoxyphenyl)iminomethyl]-7-ethyl-4-oxothieno[2,3-b]pyridine-5-carboxylic acid (PubChem CID 14223944) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-[(4-ethoxyphenyl)iminomethyl]-7-ethyl-4-oxothieno[2,3-b]pyridine-5-carboxylic acid.
| Compound Name | 2-[(4-ethoxyphenyl)iminomethyl]-7-ethyl-4-oxothieno[2,3-b]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 14223944 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2-[(4-ethoxyphenyl)iminomethyl]-7-ethyl-4-oxothieno[2,3-b]pyridine-5-carboxylic acid |
| SMILES | CCOc1ccc(/N=C/c2cc3c(=O)c(C(=O)O)cn(CC)c3s2)cc1 |
| InChI | InChI=1S/C19H18N2O4S/c1-3-21-11-16(19(23)24)17(22)15-9-14(26-18(15)21)10-20-12-5-7-13(8-6-12)25-4-2/h5-11H,3-4H2,1-2H3,(H,23,24)/b20-10+ |
| InChIKey | OSFZUVUXYROSLK-KEBDBYFISA-N |
| XLogP | 3.93 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|