C19H21NS — CID 142244078
4-[2-(2,5-dimethylphenyl)ethyl]-2-methyl-1-sulfanylindole (PubChem CID 142244078) has the molecular formula C19H21NS and a molecular weight of 295.45 g/mol. Its IUPAC name is 4-[2-(2,5-dimethylphenyl)ethyl]-2-methyl-1-sulfanylindole.
| Compound Name | 4-[2-(2,5-dimethylphenyl)ethyl]-2-methyl-1-sulfanylindole |
|---|---|
| PubChem CID | 142244078 |
| Molecular Formula | C19H21NS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 4-[2-(2,5-dimethylphenyl)ethyl]-2-methyl-1-sulfanylindole |
| SMILES | Cc1ccc(C)c(CCc2cccc3c2cc(C)n3S)c1 |
| InChI | InChI=1S/C19H21NS/c1-13-7-8-14(2)17(11-13)10-9-16-5-4-6-19-18(16)12-15(3)20(19)21/h4-8,11-12,21H,9-10H2,1-3H3 |
| InChIKey | RDHBKLGCGHAQBK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 4.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|