About 4-(furan-3-yl)azepane;(3-methylphenyl)methanol
4-(furan-3-yl)azepane;(3-methylphenyl)methanol (PubChem CID 142245478) has the molecular formula C18H25NO2
and a molecular weight of 287.40 g/mol. Its IUPAC name is 4-(furan-3-yl)azepane;(3-methylphenyl)methanol.
Molecular Properties
| Compound Name | 4-(furan-3-yl)azepane;(3-methylphenyl)methanol |
| PubChem CID | 142245478 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 4-(furan-3-yl)azepane;(3-methylphenyl)methanol |
| SMILES | Cc1cccc(CO)c1.c1cc(C2CCCNCC2)co1 |
| InChI | InChI=1S/C10H15NO.C8H10O/c1-2-9(3-6-11-5-1)10-4-7-12-8-10;1-7-3-2-4-8(5-7)6-9/h4,7-9,11H,1-3,5-6H2;2-5,9H,6H2,1H3 |
| InChIKey | CIJCXBSRXNQGHC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(furan-3-yl)azepane;(3-methylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-3-yl)azepane;(3-methylphenyl)methanol?
The IUPAC name of 4-(furan-3-yl)azepane;(3-methylphenyl)methanol (CID 142245478) is 4-(furan-3-yl)azepane;(3-methylphenyl)methanol.
What is the SMILES notation for 4-(furan-3-yl)azepane;(3-methylphenyl)methanol?
The canonical SMILES for 4-(furan-3-yl)azepane;(3-methylphenyl)methanol is Cc1cccc(CO)c1.c1cc(C2CCCNCC2)co1.
What is the InChIKey of 4-(furan-3-yl)azepane;(3-methylphenyl)methanol?
The InChIKey is CIJCXBSRXNQGHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO.C8H10O/c1-2-9(3-6-11-5-1)10-4-7-12-8-10;1-7-3-2-4-8(5-7)6-9/h4,7-9,11H,1-3,5-6H2;2-5,9H,6H2,1H3.
What are the key properties of 4-(furan-3-yl)azepane;(3-methylphenyl)methanol?
4-(furan-3-yl)azepane;(3-methylphenyl)methanol has a molecular weight of 287.40 g/mol, XLogP of 3.62, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-3-yl)azepane;(3-methylphenyl)methanol is sourced from PubChem (CID 142245478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).