About 2-ethylbutan-1-ol;4-(furan-3-yl)piperidine
2-ethylbutan-1-ol;4-(furan-3-yl)piperidine (PubChem CID 142245522) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-ethylbutan-1-ol;4-(furan-3-yl)piperidine.
Molecular Properties
| Compound Name | 2-ethylbutan-1-ol;4-(furan-3-yl)piperidine |
| PubChem CID | 142245522 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 2-ethylbutan-1-ol;4-(furan-3-yl)piperidine |
| SMILES | CCC(CC)CO.c1cc(C2CCNCC2)co1 |
| InChI | InChI=1S/C9H13NO.C6H14O/c1-4-10-5-2-8(1)9-3-6-11-7-9;1-3-6(4-2)5-7/h3,6-8,10H,1-2,4-5H2;6-7H,3-5H2,1-2H3 |
| InChIKey | JBDAKLRZERFVBR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethylbutan-1-ol;4-(furan-3-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbutan-1-ol;4-(furan-3-yl)piperidine?
The IUPAC name of 2-ethylbutan-1-ol;4-(furan-3-yl)piperidine (CID 142245522) is 2-ethylbutan-1-ol;4-(furan-3-yl)piperidine.
What is the SMILES notation for 2-ethylbutan-1-ol;4-(furan-3-yl)piperidine?
The canonical SMILES for 2-ethylbutan-1-ol;4-(furan-3-yl)piperidine is CCC(CC)CO.c1cc(C2CCNCC2)co1.
What is the InChIKey of 2-ethylbutan-1-ol;4-(furan-3-yl)piperidine?
The InChIKey is JBDAKLRZERFVBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.C6H14O/c1-4-10-5-2-8(1)9-3-6-11-7-9;1-3-6(4-2)5-7/h3,6-8,10H,1-2,4-5H2;6-7H,3-5H2,1-2H3.
What are the key properties of 2-ethylbutan-1-ol;4-(furan-3-yl)piperidine?
2-ethylbutan-1-ol;4-(furan-3-yl)piperidine has a molecular weight of 253.39 g/mol, XLogP of 3.16, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbutan-1-ol;4-(furan-3-yl)piperidine is sourced from PubChem (CID 142245522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).