About 1-(furan-3-yl)piperazine;methoxymethylbenzene
1-(furan-3-yl)piperazine;methoxymethylbenzene (PubChem CID 142245552) has the molecular formula C16H22N2O2
and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-(furan-3-yl)piperazine;methoxymethylbenzene.
Molecular Properties
| Compound Name | 1-(furan-3-yl)piperazine;methoxymethylbenzene |
| PubChem CID | 142245552 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-(furan-3-yl)piperazine;methoxymethylbenzene |
| SMILES | COCc1ccccc1.c1cc(N2CCNCC2)co1 |
| InChI | InChI=1S/C8H12N2O.C8H10O/c1-6-11-7-8(1)10-4-2-9-3-5-10;1-9-7-8-5-3-2-4-6-8/h1,6-7,9H,2-5H2;2-6H,7H2,1H3 |
| InChIKey | VUPRSQAAQWDOGQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(furan-3-yl)piperazine;methoxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-3-yl)piperazine;methoxymethylbenzene?
The IUPAC name of 1-(furan-3-yl)piperazine;methoxymethylbenzene (CID 142245552) is 1-(furan-3-yl)piperazine;methoxymethylbenzene.
What is the SMILES notation for 1-(furan-3-yl)piperazine;methoxymethylbenzene?
The canonical SMILES for 1-(furan-3-yl)piperazine;methoxymethylbenzene is COCc1ccccc1.c1cc(N2CCNCC2)co1.
What is the InChIKey of 1-(furan-3-yl)piperazine;methoxymethylbenzene?
The InChIKey is VUPRSQAAQWDOGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O.C8H10O/c1-6-11-7-8(1)10-4-2-9-3-5-10;1-9-7-8-5-3-2-4-6-8/h1,6-7,9H,2-5H2;2-6H,7H2,1H3.
What are the key properties of 1-(furan-3-yl)piperazine;methoxymethylbenzene?
1-(furan-3-yl)piperazine;methoxymethylbenzene has a molecular weight of 274.36 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-3-yl)piperazine;methoxymethylbenzene is sourced from PubChem (CID 142245552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).